C12H13Br3N2O3 — CID 80540718
2-methyl-4-[(2,4,6-tribromophenyl)carbamoylamino]butanoic acid (PubChem CID 80540718) has the molecular formula C12H13Br3N2O3 and a molecular weight of 472.96 g/mol. Its IUPAC name is 2-methyl-4-[(2,4,6-tribromophenyl)carbamoylamino]butanoic acid.
| Compound Name | 2-methyl-4-[(2,4,6-tribromophenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 80540718 |
| Molecular Formula | C12H13Br3N2O3 |
| Molecular Weight | 472.96 g/mol |
| Exact Mass | 469.85 |
| IUPAC Name | 2-methyl-4-[(2,4,6-tribromophenyl)carbamoylamino]butanoic acid |
| SMILES | CC(CCNC(=O)Nc1c(Br)cc(Br)cc1Br)C(=O)O |
| InChI | InChI=1S/C12H13Br3N2O3/c1-6(11(18)19)2-3-16-12(20)17-10-8(14)4-7(13)5-9(10)15/h4-6H,2-3H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | QPYOVZYQNKNQSM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.96 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |