2-methyl-3-(2,4,6-tribromoanilino)propanoic acid

C10H10Br3NO2 — CID 43538626

IUPAC2-methyl-3-(2,4,6-tribromoanilino)propanoic acid
SMILESCC(CNc1c(Br)cc(Br)cc1Br)C(=O)O
InChIInChI=1S/C10H10Br3NO2/c1-5(10(15)16)4-14-9-7(12)2-6(11)3-8(9)13/h2-3,5,14H,4H2,1H3,(H,15,16)
InChIKeyVAIXBBYJJOPCDR-UHFFFAOYSA-N
MW415.91 g/mol
LogP4.11
Rot. Bonds4

About 2-methyl-3-(2,4,6-tribromoanilino)propanoic acid

2-methyl-3-(2,4,6-tribromoanilino)propanoic acid (PubChem CID 43538626) has the molecular formula C10H10Br3NO2 and a molecular weight of 415.91 g/mol. Its IUPAC name is 2-methyl-3-(2,4,6-tribromoanilino)propanoic acid.

Molecular Properties

Compound Name2-methyl-3-(2,4,6-tribromoanilino)propanoic acid
PubChem CID43538626
Molecular FormulaC10H10Br3NO2
Molecular Weight415.91 g/mol
Exact Mass412.83
IUPAC Name2-methyl-3-(2,4,6-tribromoanilino)propanoic acid
SMILESCC(CNc1c(Br)cc(Br)cc1Br)C(=O)O
InChIInChI=1S/C10H10Br3NO2/c1-5(10(15)16)4-14-9-7(12)2-6(11)3-8(9)13/h2-3,5,14H,4H2,1H3,(H,15,16)
InChIKeyVAIXBBYJJOPCDR-UHFFFAOYSA-N
XLogP4.11
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500415.91
LogP ≤ 54.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-methyl-3-(2,4,6-tribromoanilino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-3-(2,4,6-tribromoanilino)propanoic acid?
The IUPAC name of 2-methyl-3-(2,4,6-tribromoanilino)propanoic acid (CID 43538626) is 2-methyl-3-(2,4,6-tribromoanilino)propanoic acid.
What is the SMILES notation for 2-methyl-3-(2,4,6-tribromoanilino)propanoic acid?
The canonical SMILES for 2-methyl-3-(2,4,6-tribromoanilino)propanoic acid is CC(CNc1c(Br)cc(Br)cc1Br)C(=O)O.
What is the InChIKey of 2-methyl-3-(2,4,6-tribromoanilino)propanoic acid?
The InChIKey is VAIXBBYJJOPCDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Br3NO2/c1-5(10(15)16)4-14-9-7(12)2-6(11)3-8(9)13/h2-3,5,14H,4H2,1H3,(H,15,16).
What are the key properties of 2-methyl-3-(2,4,6-tribromoanilino)propanoic acid?
2-methyl-3-(2,4,6-tribromoanilino)propanoic acid has a molecular weight of 415.91 g/mol, XLogP of 4.11, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(2,4,6-tribromoanilino)propanoic acid is sourced from PubChem (CID 43538626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).