C11H12Br3NO2 — CID 79201496
4-hydroxy-N-(2,4,6-tribromophenyl)pentanamide (PubChem CID 79201496) has the molecular formula C11H12Br3NO2 and a molecular weight of 429.93 g/mol. Its IUPAC name is 4-hydroxy-N-(2,4,6-tribromophenyl)pentanamide.
| Compound Name | 4-hydroxy-N-(2,4,6-tribromophenyl)pentanamide |
|---|---|
| PubChem CID | 79201496 |
| Molecular Formula | C11H12Br3NO2 |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 426.84 |
| IUPAC Name | 4-hydroxy-N-(2,4,6-tribromophenyl)pentanamide |
| SMILES | CC(O)CCC(=O)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C11H12Br3NO2/c1-6(16)2-3-10(17)15-11-8(13)4-7(12)5-9(11)14/h4-6,16H,2-3H2,1H3,(H,15,17) |
| InChIKey | NWUPYDOAHPFZEV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |