C10H10Br3NO — CID 115571577
3-bromo-N-(2,6-dibromo-4-methylphenyl)propanamide (PubChem CID 115571577) has the molecular formula C10H10Br3NO and a molecular weight of 399.91 g/mol. Its IUPAC name is 3-bromo-N-(2,6-dibromo-4-methylphenyl)propanamide.
| Compound Name | 3-bromo-N-(2,6-dibromo-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 115571577 |
| Molecular Formula | C10H10Br3NO |
| Molecular Weight | 399.91 g/mol |
| Exact Mass | 396.83 |
| IUPAC Name | 3-bromo-N-(2,6-dibromo-4-methylphenyl)propanamide |
| SMILES | Cc1cc(Br)c(NC(=O)CCBr)c(Br)c1 |
| InChI | InChI=1S/C10H10Br3NO/c1-6-4-7(12)10(8(13)5-6)14-9(15)2-3-11/h4-5H,2-3H2,1H3,(H,14,15) |
| InChIKey | XQNZWNQHAJULFW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.91 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|