C12H15Br3N2O — CID 60854870
3-(propan-2-ylamino)-N-(2,4,6-tribromophenyl)propanamide (PubChem CID 60854870) has the molecular formula C12H15Br3N2O and a molecular weight of 442.98 g/mol. Its IUPAC name is 3-(propan-2-ylamino)-N-(2,4,6-tribromophenyl)propanamide.
| Compound Name | 3-(propan-2-ylamino)-N-(2,4,6-tribromophenyl)propanamide |
|---|---|
| PubChem CID | 60854870 |
| Molecular Formula | C12H15Br3N2O |
| Molecular Weight | 442.98 g/mol |
| Exact Mass | 439.87 |
| IUPAC Name | 3-(propan-2-ylamino)-N-(2,4,6-tribromophenyl)propanamide |
| SMILES | CC(C)NCCC(=O)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C12H15Br3N2O/c1-7(2)16-4-3-11(18)17-12-9(14)5-8(13)6-10(12)15/h5-7,16H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | ZOHKQWKCWOAYMF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.98 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |