C12H14Br2N2O3 — CID 63112292
3,5-dibromo-2-[4-(methylamino)butanoylamino]benzoic acid (PubChem CID 63112292) has the molecular formula C12H14Br2N2O3 and a molecular weight of 394.06 g/mol. Its IUPAC name is 3,5-dibromo-2-[4-(methylamino)butanoylamino]benzoic acid.
| Compound Name | 3,5-dibromo-2-[4-(methylamino)butanoylamino]benzoic acid |
|---|---|
| PubChem CID | 63112292 |
| Molecular Formula | C12H14Br2N2O3 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | 3,5-dibromo-2-[4-(methylamino)butanoylamino]benzoic acid |
| SMILES | CNCCCC(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C12H14Br2N2O3/c1-15-4-2-3-10(17)16-11-8(12(18)19)5-7(13)6-9(11)14/h5-6,15H,2-4H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | BLWQWFNQBOJVOF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|