C14H16Br2N2O3 — CID 81172576
2-[[2-[1-(aminomethyl)cyclobutyl]acetyl]amino]-3,5-dibromobenzoic acid (PubChem CID 81172576) has the molecular formula C14H16Br2N2O3 and a molecular weight of 420.10 g/mol. Its IUPAC name is 2-[[2-[1-(aminomethyl)cyclobutyl]acetyl]amino]-3,5-dibromobenzoic acid.
| Compound Name | 2-[[2-[1-(aminomethyl)cyclobutyl]acetyl]amino]-3,5-dibromobenzoic acid |
|---|---|
| PubChem CID | 81172576 |
| Molecular Formula | C14H16Br2N2O3 |
| Molecular Weight | 420.10 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | 2-[[2-[1-(aminomethyl)cyclobutyl]acetyl]amino]-3,5-dibromobenzoic acid |
| SMILES | NCC1(CC(=O)Nc2c(Br)cc(Br)cc2C(=O)O)CCC1 |
| InChI | InChI=1S/C14H16Br2N2O3/c15-8-4-9(13(20)21)12(10(16)5-8)18-11(19)6-14(7-17)2-1-3-14/h4-5H,1-3,6-7,17H2,(H,18,19)(H,20,21) |
| InChIKey | APZJHMDKIFVYRM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.10 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |