C14H16Br2N2O3 — CID 63219116
3,5-dibromo-2-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]benzoic acid (PubChem CID 63219116) has the molecular formula C14H16Br2N2O3 and a molecular weight of 420.10 g/mol. Its IUPAC name is 3,5-dibromo-2-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]benzoic acid.
| Compound Name | 3,5-dibromo-2-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 63219116 |
| Molecular Formula | C14H16Br2N2O3 |
| Molecular Weight | 420.10 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | 3,5-dibromo-2-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]benzoic acid |
| SMILES | CC1(C)CCCN1C(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C14H16Br2N2O3/c1-14(2)4-3-5-18(14)13(21)17-11-9(12(19)20)6-8(15)7-10(11)16/h6-7H,3-5H2,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | ZJNNIGHIWAKRBP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.10 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |