C14H18N2O4 — CID 63219066
5-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]-2-hydroxybenzoic acid (PubChem CID 63219066) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 63219066 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 5-[(2,2-dimethylpyrrolidine-1-carbonyl)amino]-2-hydroxybenzoic acid |
| SMILES | CC1(C)CCCN1C(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H18N2O4/c1-14(2)6-3-7-16(14)13(20)15-9-4-5-11(17)10(8-9)12(18)19/h4-5,8,17H,3,6-7H2,1-2H3,(H,15,20)(H,18,19) |
| InChIKey | GGIVUXYUOJKBEQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|