C14H16N2O5 — CID 66369326
2-hydroxy-5-(8-oxa-3-azabicyclo[3.2.1]octane-3-carbonylamino)benzoic acid (PubChem CID 66369326) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-hydroxy-5-(8-oxa-3-azabicyclo[3.2.1]octane-3-carbonylamino)benzoic acid.
| Compound Name | 2-hydroxy-5-(8-oxa-3-azabicyclo[3.2.1]octane-3-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 66369326 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-hydroxy-5-(8-oxa-3-azabicyclo[3.2.1]octane-3-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)N2CC3CCC(C2)O3)ccc1O |
| InChI | InChI=1S/C14H16N2O5/c17-12-4-1-8(5-11(12)13(18)19)15-14(20)16-6-9-2-3-10(7-16)21-9/h1,4-5,9-10,17H,2-3,6-7H2,(H,15,20)(H,18,19) |
| InChIKey | RRMFIGBSRDMYIV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|