C13H16N2O5 — CID 106670762
5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-2-methylbenzoic acid (PubChem CID 106670762) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-2-methylbenzoic acid.
| Compound Name | 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 106670762 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-2-methylbenzoic acid |
| SMILES | Cc1ccc(NC(=O)N2CC(O)C(O)C2)cc1C(=O)O |
| InChI | InChI=1S/C13H16N2O5/c1-7-2-3-8(4-9(7)12(18)19)14-13(20)15-5-10(16)11(17)6-15/h2-4,10-11,16-17H,5-6H2,1H3,(H,14,20)(H,18,19) |
| InChIKey | TWOXYDCVCIXWAB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |