C13H18N2O2 — CID 111430925
(3R)-N-(3,4-dimethylphenyl)-3-hydroxypyrrolidine-1-carboxamide (PubChem CID 111430925) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (3R)-N-(3,4-dimethylphenyl)-3-hydroxypyrrolidine-1-carboxamide.
| Compound Name | (3R)-N-(3,4-dimethylphenyl)-3-hydroxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111430925 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (3R)-N-(3,4-dimethylphenyl)-3-hydroxypyrrolidine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CC[C@@H](O)C2)cc1C |
| InChI | InChI=1S/C13H18N2O2/c1-9-3-4-11(7-10(9)2)14-13(17)15-6-5-12(16)8-15/h3-4,7,12,16H,5-6,8H2,1-2H3,(H,14,17)/t12-/m1/s1 |
| InChIKey | IAHNDVHIUBQTRJ-GFCCVEGCSA-N |
| XLogP | 1.90 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |