C13H15FN2O3 — CID 146596384
(3R)-N-(4-acetyl-3-fluorophenyl)-3-hydroxypyrrolidine-1-carboxamide (PubChem CID 146596384) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is (3R)-N-(4-acetyl-3-fluorophenyl)-3-hydroxypyrrolidine-1-carboxamide.
| Compound Name | (3R)-N-(4-acetyl-3-fluorophenyl)-3-hydroxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 146596384 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (3R)-N-(4-acetyl-3-fluorophenyl)-3-hydroxypyrrolidine-1-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)N2CC[C@@H](O)C2)cc1F |
| InChI | InChI=1S/C13H15FN2O3/c1-8(17)11-3-2-9(6-12(11)14)15-13(19)16-5-4-10(18)7-16/h2-3,6,10,18H,4-5,7H2,1H3,(H,15,19)/t10-/m1/s1 |
| InChIKey | CCJVKNWGBWUWEA-SNVBAGLBSA-N |
| XLogP | 1.63 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |