C10H11Br2N3O3 — CID 83019246
3,5-dibromo-2-(dimethylaminocarbamoylamino)benzoic acid (PubChem CID 83019246) has the molecular formula C10H11Br2N3O3 and a molecular weight of 381.02 g/mol. Its IUPAC name is 3,5-dibromo-2-(dimethylaminocarbamoylamino)benzoic acid.
| Compound Name | 3,5-dibromo-2-(dimethylaminocarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 83019246 |
| Molecular Formula | C10H11Br2N3O3 |
| Molecular Weight | 381.02 g/mol |
| Exact Mass | 378.92 |
| IUPAC Name | 3,5-dibromo-2-(dimethylaminocarbamoylamino)benzoic acid |
| SMILES | CN(C)NC(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C10H11Br2N3O3/c1-15(2)14-10(18)13-8-6(9(16)17)3-5(11)4-7(8)12/h3-4H,1-2H3,(H,16,17)(H2,13,14,18) |
| InChIKey | KJNGLGTZTSGACE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.02 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|