C14H18Br2N2O3 — CID 63112320
3,5-dibromo-2-[[methyl(pentan-3-yl)carbamoyl]amino]benzoic acid (PubChem CID 63112320) has the molecular formula C14H18Br2N2O3 and a molecular weight of 422.12 g/mol. Its IUPAC name is 3,5-dibromo-2-[[methyl(pentan-3-yl)carbamoyl]amino]benzoic acid.
| Compound Name | 3,5-dibromo-2-[[methyl(pentan-3-yl)carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 63112320 |
| Molecular Formula | C14H18Br2N2O3 |
| Molecular Weight | 422.12 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | 3,5-dibromo-2-[[methyl(pentan-3-yl)carbamoyl]amino]benzoic acid |
| SMILES | CCC(CC)N(C)C(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C14H18Br2N2O3/c1-4-9(5-2)18(3)14(21)17-12-10(13(19)20)6-8(15)7-11(12)16/h6-7,9H,4-5H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | ZTXOYPYAYIWGGT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.12 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |