C14H16Br2N2O3 — CID 63112329
3,5-dibromo-2-[[ethyl(2-methylprop-2-enyl)carbamoyl]amino]benzoic acid (PubChem CID 63112329) has the molecular formula C14H16Br2N2O3 and a molecular weight of 420.10 g/mol. Its IUPAC name is 3,5-dibromo-2-[[ethyl(2-methylprop-2-enyl)carbamoyl]amino]benzoic acid.
| Compound Name | 3,5-dibromo-2-[[ethyl(2-methylprop-2-enyl)carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 63112329 |
| Molecular Formula | C14H16Br2N2O3 |
| Molecular Weight | 420.10 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | 3,5-dibromo-2-[[ethyl(2-methylprop-2-enyl)carbamoyl]amino]benzoic acid |
| SMILES | C=C(C)CN(CC)C(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C14H16Br2N2O3/c1-4-18(7-8(2)3)14(21)17-12-10(13(19)20)5-9(15)6-11(12)16/h5-6H,2,4,7H2,1,3H3,(H,17,21)(H,19,20) |
| InChIKey | HZRFADRQKVTMQI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.10 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|