C12H12Br2N2O5 — CID 63112343
3,5-dibromo-2-[(2-ethoxy-2-oxoethyl)carbamoylamino]benzoic acid (PubChem CID 63112343) has the molecular formula C12H12Br2N2O5 and a molecular weight of 424.05 g/mol. Its IUPAC name is 3,5-dibromo-2-[(2-ethoxy-2-oxoethyl)carbamoylamino]benzoic acid.
| Compound Name | 3,5-dibromo-2-[(2-ethoxy-2-oxoethyl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 63112343 |
| Molecular Formula | C12H12Br2N2O5 |
| Molecular Weight | 424.05 g/mol |
| Exact Mass | 421.91 |
| IUPAC Name | 3,5-dibromo-2-[(2-ethoxy-2-oxoethyl)carbamoylamino]benzoic acid |
| SMILES | CCOC(=O)CNC(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C12H12Br2N2O5/c1-2-21-9(17)5-15-12(20)16-10-7(11(18)19)3-6(13)4-8(10)14/h3-4H,2,5H2,1H3,(H,18,19)(H2,15,16,20) |
| InChIKey | JQUBWGUFFDBZHB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.05 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |