C13H10Br2N2O3S — CID 63244637
3,5-dibromo-2-(thiophen-3-ylmethylcarbamoylamino)benzoic acid (PubChem CID 63244637) has the molecular formula C13H10Br2N2O3S and a molecular weight of 434.11 g/mol. Its IUPAC name is 3,5-dibromo-2-(thiophen-3-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 3,5-dibromo-2-(thiophen-3-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 63244637 |
| Molecular Formula | C13H10Br2N2O3S |
| Molecular Weight | 434.11 g/mol |
| Exact Mass | 431.88 |
| IUPAC Name | 3,5-dibromo-2-(thiophen-3-ylmethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCc1ccsc1)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C13H10Br2N2O3S/c14-8-3-9(12(18)19)11(10(15)4-8)17-13(20)16-5-7-1-2-21-6-7/h1-4,6H,5H2,(H,18,19)(H2,16,17,20) |
| InChIKey | PMQZPKFPTMXUES-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.11 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |