C13H11BrN2O3S — CID 63244279
4-bromo-2-(thiophen-3-ylmethylcarbamoylamino)benzoic acid (PubChem CID 63244279) has the molecular formula C13H11BrN2O3S and a molecular weight of 355.21 g/mol. Its IUPAC name is 4-bromo-2-(thiophen-3-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 4-bromo-2-(thiophen-3-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 63244279 |
| Molecular Formula | C13H11BrN2O3S |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 4-bromo-2-(thiophen-3-ylmethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCc1ccsc1)Nc1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C13H11BrN2O3S/c14-9-1-2-10(12(17)18)11(5-9)16-13(19)15-6-8-3-4-20-7-8/h1-5,7H,6H2,(H,17,18)(H2,15,16,19) |
| InChIKey | YRKNYSVLUNEWLE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |