C11H13BrN4O4 — CID 83113089
4-bromo-2-[2-(carbamoylamino)ethylcarbamoylamino]benzoic acid (PubChem CID 83113089) has the molecular formula C11H13BrN4O4 and a molecular weight of 345.15 g/mol. Its IUPAC name is 4-bromo-2-[2-(carbamoylamino)ethylcarbamoylamino]benzoic acid.
| Compound Name | 4-bromo-2-[2-(carbamoylamino)ethylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 83113089 |
| Molecular Formula | C11H13BrN4O4 |
| Molecular Weight | 345.15 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 4-bromo-2-[2-(carbamoylamino)ethylcarbamoylamino]benzoic acid |
| SMILES | NC(=O)NCCNC(=O)Nc1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C11H13BrN4O4/c12-6-1-2-7(9(17)18)8(5-6)16-11(20)15-4-3-14-10(13)19/h1-2,5H,3-4H2,(H,17,18)(H3,13,14,19)(H2,15,16,20) |
| InChIKey | QKBCIOXHKNLTOD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.15 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|