C11H12BrNO4 — CID 162371314
5-bromo-2-(ethoxycarbonylamino)-3-methylbenzoic acid (PubChem CID 162371314) has the molecular formula C11H12BrNO4 and a molecular weight of 302.12 g/mol. Its IUPAC name is 5-bromo-2-(ethoxycarbonylamino)-3-methylbenzoic acid.
| Compound Name | 5-bromo-2-(ethoxycarbonylamino)-3-methylbenzoic acid |
|---|---|
| PubChem CID | 162371314 |
| Molecular Formula | C11H12BrNO4 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 5-bromo-2-(ethoxycarbonylamino)-3-methylbenzoic acid |
| SMILES | CCOC(=O)Nc1c(C)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C11H12BrNO4/c1-3-17-11(16)13-9-6(2)4-7(12)5-8(9)10(14)15/h4-5H,3H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | VJOLEQQHBNGBRT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |