C11H10F4N2O3 — CID 103601355
ethyl 2-[(2,3,5,6-tetrafluorophenyl)carbamoylamino]acetate (PubChem CID 103601355) has the molecular formula C11H10F4N2O3 and a molecular weight of 294.20 g/mol. Its IUPAC name is ethyl 2-[(2,3,5,6-tetrafluorophenyl)carbamoylamino]acetate.
| Compound Name | ethyl 2-[(2,3,5,6-tetrafluorophenyl)carbamoylamino]acetate |
|---|---|
| PubChem CID | 103601355 |
| Molecular Formula | C11H10F4N2O3 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | ethyl 2-[(2,3,5,6-tetrafluorophenyl)carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C11H10F4N2O3/c1-2-20-7(18)4-16-11(19)17-10-8(14)5(12)3-6(13)9(10)15/h3H,2,4H2,1H3,(H2,16,17,19) |
| InChIKey | GGSSPQBZLDSQJI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|