C11H17N3O3 — CID 108895532
1-(3,5-dihydroxyphenyl)-3-[2-(dimethylamino)ethyl]urea (PubChem CID 108895532) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is 1-(3,5-dihydroxyphenyl)-3-[2-(dimethylamino)ethyl]urea.
| Compound Name | 1-(3,5-dihydroxyphenyl)-3-[2-(dimethylamino)ethyl]urea |
|---|---|
| PubChem CID | 108895532 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-(3,5-dihydroxyphenyl)-3-[2-(dimethylamino)ethyl]urea |
| SMILES | CN(C)CCNC(=O)Nc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H17N3O3/c1-14(2)4-3-12-11(17)13-8-5-9(15)7-10(16)6-8/h5-7,15-16H,3-4H2,1-2H3,(H2,12,13,17) |
| InChIKey | FMQITLTWPVDTQS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |