C14H18F2N2O3 — CID 62866986
4,5-difluoro-2-(3-methylpentan-2-ylcarbamoylamino)benzoic acid (PubChem CID 62866986) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is 4,5-difluoro-2-(3-methylpentan-2-ylcarbamoylamino)benzoic acid.
| Compound Name | 4,5-difluoro-2-(3-methylpentan-2-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 62866986 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4,5-difluoro-2-(3-methylpentan-2-ylcarbamoylamino)benzoic acid |
| SMILES | CCC(C)C(C)NC(=O)Nc1cc(F)c(F)cc1C(=O)O |
| InChI | InChI=1S/C14H18F2N2O3/c1-4-7(2)8(3)17-14(21)18-12-6-11(16)10(15)5-9(12)13(19)20/h5-8H,4H2,1-3H3,(H,19,20)(H2,17,18,21) |
| InChIKey | VVLRSDYLHMGCSX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |