C13H15FN2O5 — CID 122095047
4-[(2-fluoro-3-methoxycarbonylphenyl)carbamoylamino]butanoic acid (PubChem CID 122095047) has the molecular formula C13H15FN2O5 and a molecular weight of 298.27 g/mol. Its IUPAC name is 4-[(2-fluoro-3-methoxycarbonylphenyl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(2-fluoro-3-methoxycarbonylphenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122095047 |
| Molecular Formula | C13H15FN2O5 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 4-[(2-fluoro-3-methoxycarbonylphenyl)carbamoylamino]butanoic acid |
| SMILES | COC(=O)c1cccc(NC(=O)NCCCC(=O)O)c1F |
| InChI | InChI=1S/C13H15FN2O5/c1-21-12(19)8-4-2-5-9(11(8)14)16-13(20)15-7-3-6-10(17)18/h2,4-5H,3,6-7H2,1H3,(H,17,18)(H2,15,16,20) |
| InChIKey | FAGDHWGFYQEMDO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|