C12H15FN2O5 — CID 122079674
3-[(2-fluoro-4,5-dimethoxyphenyl)carbamoylamino]propanoic acid (PubChem CID 122079674) has the molecular formula C12H15FN2O5 and a molecular weight of 286.26 g/mol. Its IUPAC name is 3-[(2-fluoro-4,5-dimethoxyphenyl)carbamoylamino]propanoic acid.
| Compound Name | 3-[(2-fluoro-4,5-dimethoxyphenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122079674 |
| Molecular Formula | C12H15FN2O5 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-[(2-fluoro-4,5-dimethoxyphenyl)carbamoylamino]propanoic acid |
| SMILES | COc1cc(F)c(NC(=O)NCCC(=O)O)cc1OC |
| InChI | InChI=1S/C12H15FN2O5/c1-19-9-5-7(13)8(6-10(9)20-2)15-12(18)14-4-3-11(16)17/h5-6H,3-4H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | GBJCKAINGSQUBU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |