3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid

C12H16N2O5 — CID 108867767

IUPAC3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid
SMILESCOc1cccc(OC)c1NC(=O)NCCC(=O)O
InChIInChI=1S/C12H16N2O5/c1-18-8-4-3-5-9(19-2)11(8)14-12(17)13-7-6-10(15)16/h3-5H,6-7H2,1-2H3,(H,15,16)(H2,13,14,17)
InChIKeyZIBZTFLTAZTZGY-UHFFFAOYSA-N
MW268.27 g/mol
LogP1.30
Rot. Bonds6

About 3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid

3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid (PubChem CID 108867767) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid.

Molecular Properties

Compound Name3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid
PubChem CID108867767
Molecular FormulaC12H16N2O5
Molecular Weight268.27 g/mol
Exact Mass268.11
IUPAC Name3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid
SMILESCOc1cccc(OC)c1NC(=O)NCCC(=O)O
InChIInChI=1S/C12H16N2O5/c1-18-8-4-3-5-9(19-2)11(8)14-12(17)13-7-6-10(15)16/h3-5H,6-7H2,1-2H3,(H,15,16)(H2,13,14,17)
InChIKeyZIBZTFLTAZTZGY-UHFFFAOYSA-N
XLogP1.30
TPSA96.89 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.27
LogP ≤ 51.30
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid?
The IUPAC name of 3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid (CID 108867767) is 3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid.
What is the SMILES notation for 3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid?
The canonical SMILES for 3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid is COc1cccc(OC)c1NC(=O)NCCC(=O)O.
What is the InChIKey of 3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid?
The InChIKey is ZIBZTFLTAZTZGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O5/c1-18-8-4-3-5-9(19-2)11(8)14-12(17)13-7-6-10(15)16/h3-5H,6-7H2,1-2H3,(H,15,16)(H2,13,14,17).
What are the key properties of 3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid?
3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid has a molecular weight of 268.27 g/mol, XLogP of 1.30, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dimethoxyphenyl)carbamoylamino]propanoic acid is sourced from PubChem (CID 108867767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).