C10H13FN2O3 — CID 119320405
2-amino-N-(2-fluoro-4,5-dimethoxyphenyl)acetamide (PubChem CID 119320405) has the molecular formula C10H13FN2O3 and a molecular weight of 228.22 g/mol. Its IUPAC name is 2-amino-N-(2-fluoro-4,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-amino-N-(2-fluoro-4,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 119320405 |
| Molecular Formula | C10H13FN2O3 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-amino-N-(2-fluoro-4,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(F)c(NC(=O)CN)cc1OC |
| InChI | InChI=1S/C10H13FN2O3/c1-15-8-3-6(11)7(4-9(8)16-2)13-10(14)5-12/h3-4H,5,12H2,1-2H3,(H,13,14) |
| InChIKey | CELYEWBHEGNLLJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |