C17H20N4O4 — CID 39184918
2-amino-N-[4,5-dimethoxy-2-(phenylcarbamoylamino)phenyl]acetamide (PubChem CID 39184918) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-amino-N-[4,5-dimethoxy-2-(phenylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2-amino-N-[4,5-dimethoxy-2-(phenylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 39184918 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-amino-N-[4,5-dimethoxy-2-(phenylcarbamoylamino)phenyl]acetamide |
| SMILES | COc1cc(NC(=O)CN)c(NC(=O)Nc2ccccc2)cc1OC |
| InChI | InChI=1S/C17H20N4O4/c1-24-14-8-12(20-16(22)10-18)13(9-15(14)25-2)21-17(23)19-11-6-4-3-5-7-11/h3-9H,10,18H2,1-2H3,(H,20,22)(H2,19,21,23) |
| InChIKey | NKMDSCHHNSRWQF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |