C15H16N2O4 — CID 22099500
1-(5-hydroxy-2,4-dimethoxyphenyl)-3-phenylurea (PubChem CID 22099500) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 1-(5-hydroxy-2,4-dimethoxyphenyl)-3-phenylurea.
| Compound Name | 1-(5-hydroxy-2,4-dimethoxyphenyl)-3-phenylurea |
|---|---|
| PubChem CID | 22099500 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-(5-hydroxy-2,4-dimethoxyphenyl)-3-phenylurea |
| SMILES | COc1cc(OC)c(NC(=O)Nc2ccccc2)cc1O |
| InChI | InChI=1S/C15H16N2O4/c1-20-13-9-14(21-2)12(18)8-11(13)17-15(19)16-10-6-4-3-5-7-10/h3-9,18H,1-2H3,(H2,16,17,19) |
| InChIKey | HLYZZJJRULYOMI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |