C26H27N3O6 — CID 70105157
ethyl 4-hydroxy-5-methoxy-2-[2-[4-(phenylcarbamoylamino)phenyl]propanoylamino]benzoate (PubChem CID 70105157) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is ethyl 4-hydroxy-5-methoxy-2-[2-[4-(phenylcarbamoylamino)phenyl]propanoylamino]benzoate.
| Compound Name | ethyl 4-hydroxy-5-methoxy-2-[2-[4-(phenylcarbamoylamino)phenyl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 70105157 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | ethyl 4-hydroxy-5-methoxy-2-[2-[4-(phenylcarbamoylamino)phenyl]propanoylamino]benzoate |
| SMILES | CCOC(=O)c1cc(OC)c(O)cc1NC(=O)C(C)c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C26H27N3O6/c1-4-35-25(32)20-14-23(34-3)22(30)15-21(20)29-24(31)16(2)17-10-12-19(13-11-17)28-26(33)27-18-8-6-5-7-9-18/h5-16,30H,4H2,1-3H3,(H,29,31)(H2,27,28,33) |
| InChIKey | SZMCPSLAFWHTKJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |