C28H31N3O6 — CID 70107357
ethyl 4-ethoxy-5-methoxy-2-[2-[4-(phenylcarbamoylamino)phenyl]propanoylamino]benzoate (PubChem CID 70107357) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is ethyl 4-ethoxy-5-methoxy-2-[2-[4-(phenylcarbamoylamino)phenyl]propanoylamino]benzoate.
| Compound Name | ethyl 4-ethoxy-5-methoxy-2-[2-[4-(phenylcarbamoylamino)phenyl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 70107357 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | ethyl 4-ethoxy-5-methoxy-2-[2-[4-(phenylcarbamoylamino)phenyl]propanoylamino]benzoate |
| SMILES | CCOC(=O)c1cc(OC)c(OCC)cc1NC(=O)C(C)c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C28H31N3O6/c1-5-36-25-17-23(22(16-24(25)35-4)27(33)37-6-2)31-26(32)18(3)19-12-14-21(15-13-19)30-28(34)29-20-10-8-7-9-11-20/h7-18H,5-6H2,1-4H3,(H,31,32)(H2,29,30,34) |
| InChIKey | MOAUIYBPCUMTHH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |