C16H15FN2O4 — CID 162371292
1-(5-acetyl-4-hydroxy-2-methoxyphenyl)-3-(4-fluorophenyl)urea (PubChem CID 162371292) has the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. Its IUPAC name is 1-(5-acetyl-4-hydroxy-2-methoxyphenyl)-3-(4-fluorophenyl)urea.
| Compound Name | 1-(5-acetyl-4-hydroxy-2-methoxyphenyl)-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 162371292 |
| Molecular Formula | C16H15FN2O4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-(5-acetyl-4-hydroxy-2-methoxyphenyl)-3-(4-fluorophenyl)urea |
| SMILES | COc1cc(O)c(C(C)=O)cc1NC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN2O4/c1-9(20)12-7-13(15(23-2)8-14(12)21)19-16(22)18-11-5-3-10(17)4-6-11/h3-8,21H,1-2H3,(H2,18,19,22) |
| InChIKey | IBIXOOFKIPICBV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|