C14H21FN2O3 — CID 119778135
2-amino-N-(2-fluoro-4,5-dimethoxyphenyl)-2-methylpentanamide (PubChem CID 119778135) has the molecular formula C14H21FN2O3 and a molecular weight of 284.33 g/mol. Its IUPAC name is 2-amino-N-(2-fluoro-4,5-dimethoxyphenyl)-2-methylpentanamide.
| Compound Name | 2-amino-N-(2-fluoro-4,5-dimethoxyphenyl)-2-methylpentanamide |
|---|---|
| PubChem CID | 119778135 |
| Molecular Formula | C14H21FN2O3 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-amino-N-(2-fluoro-4,5-dimethoxyphenyl)-2-methylpentanamide |
| SMILES | CCCC(C)(N)C(=O)Nc1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C14H21FN2O3/c1-5-6-14(2,16)13(18)17-10-8-12(20-4)11(19-3)7-9(10)15/h7-8H,5-6,16H2,1-4H3,(H,17,18) |
| InChIKey | QUUPFEZTWUWDFV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |