C10H10BrFN2O4 — CID 142875143
3-[(5-bromo-3-fluoro-2-hydroxyphenyl)carbamoylamino]propanoic acid (PubChem CID 142875143) has the molecular formula C10H10BrFN2O4 and a molecular weight of 321.10 g/mol. Its IUPAC name is 3-[(5-bromo-3-fluoro-2-hydroxyphenyl)carbamoylamino]propanoic acid.
| Compound Name | 3-[(5-bromo-3-fluoro-2-hydroxyphenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 142875143 |
| Molecular Formula | C10H10BrFN2O4 |
| Molecular Weight | 321.10 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 3-[(5-bromo-3-fluoro-2-hydroxyphenyl)carbamoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)Nc1cc(Br)cc(F)c1O |
| InChI | InChI=1S/C10H10BrFN2O4/c11-5-3-6(12)9(17)7(4-5)14-10(18)13-2-1-8(15)16/h3-4,17H,1-2H2,(H,15,16)(H2,13,14,18) |
| InChIKey | GUQWMSAKDVOLHI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.10 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|