C11H15ClN2O — CID 10105129
1-(2-chloroethyl)-3-(3,4-dimethylphenyl)urea (PubChem CID 10105129) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1-(2-chloroethyl)-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 10105129 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-(2-chloroethyl)-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCCCl)cc1C |
| InChI | InChI=1S/C11H15ClN2O/c1-8-3-4-10(7-9(8)2)14-11(15)13-6-5-12/h3-4,7H,5-6H2,1-2H3,(H2,13,14,15) |
| InChIKey | DOOYSSXJVUAVEJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|