C11H14N2O3 — CID 108894947
1-(3-hydroxyphenyl)-3-(3-oxobutyl)urea (PubChem CID 108894947) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 1-(3-hydroxyphenyl)-3-(3-oxobutyl)urea.
| Compound Name | 1-(3-hydroxyphenyl)-3-(3-oxobutyl)urea |
|---|---|
| PubChem CID | 108894947 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1-(3-hydroxyphenyl)-3-(3-oxobutyl)urea |
| SMILES | CC(=O)CCNC(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C11H14N2O3/c1-8(14)5-6-12-11(16)13-9-3-2-4-10(15)7-9/h2-4,7,15H,5-6H2,1H3,(H2,12,13,16) |
| InChIKey | RBALIWFAJYEEDN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |