C13H15N3O2 — CID 58032873
1-(3-cyanophenyl)-3-(4-oxopentyl)urea (PubChem CID 58032873) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-(4-oxopentyl)urea.
| Compound Name | 1-(3-cyanophenyl)-3-(4-oxopentyl)urea |
|---|---|
| PubChem CID | 58032873 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-(3-cyanophenyl)-3-(4-oxopentyl)urea |
| SMILES | CC(=O)CCCNC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C13H15N3O2/c1-10(17)4-3-7-15-13(18)16-12-6-2-5-11(8-12)9-14/h2,5-6,8H,3-4,7H2,1H3,(H2,15,16,18) |
| InChIKey | KRACJUXRRFIMBK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|