C19H21N3O4 — CID 113217348
1-(3-cyanophenyl)-3-[2-(2,4,5-trimethoxyphenyl)ethyl]urea (PubChem CID 113217348) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[2-(2,4,5-trimethoxyphenyl)ethyl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[2-(2,4,5-trimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 113217348 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[2-(2,4,5-trimethoxyphenyl)ethyl]urea |
| SMILES | COc1cc(OC)c(OC)cc1CCNC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C19H21N3O4/c1-24-16-11-18(26-3)17(25-2)10-14(16)7-8-21-19(23)22-15-6-4-5-13(9-15)12-20/h4-6,9-11H,7-8H2,1-3H3,(H2,21,22,23) |
| InChIKey | CLTRMORYFPXSKL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |