C22H30N2O4 — CID 113217295
1-(2,6-diethylphenyl)-3-[2-(2,4,5-trimethoxyphenyl)ethyl]urea (PubChem CID 113217295) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-[2-(2,4,5-trimethoxyphenyl)ethyl]urea.
| Compound Name | 1-(2,6-diethylphenyl)-3-[2-(2,4,5-trimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 113217295 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-[2-(2,4,5-trimethoxyphenyl)ethyl]urea |
| SMILES | CCc1cccc(CC)c1NC(=O)NCCc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C22H30N2O4/c1-6-15-9-8-10-16(7-2)21(15)24-22(25)23-12-11-17-13-19(27-4)20(28-5)14-18(17)26-3/h8-10,13-14H,6-7,11-12H2,1-5H3,(H2,23,24,25) |
| InChIKey | NQOGPFDZPFSWFR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |