C11H16N2O4 — CID 108895499
1-(3,5-dihydroxyphenyl)-3-(1-hydroxybutan-2-yl)urea (PubChem CID 108895499) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 1-(3,5-dihydroxyphenyl)-3-(1-hydroxybutan-2-yl)urea.
| Compound Name | 1-(3,5-dihydroxyphenyl)-3-(1-hydroxybutan-2-yl)urea |
|---|---|
| PubChem CID | 108895499 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-(3,5-dihydroxyphenyl)-3-(1-hydroxybutan-2-yl)urea |
| SMILES | CCC(CO)NC(=O)Nc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H16N2O4/c1-2-7(6-14)12-11(17)13-8-3-9(15)5-10(16)4-8/h3-5,7,14-16H,2,6H2,1H3,(H2,12,13,17) |
| InChIKey | MIHHDQMQAXHABZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |