C6H14N2O2 — CID 115279269
1-(1-hydroxybutan-2-yl)-3-methylurea (PubChem CID 115279269) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 1-(1-hydroxybutan-2-yl)-3-methylurea.
| Compound Name | 1-(1-hydroxybutan-2-yl)-3-methylurea |
|---|---|
| PubChem CID | 115279269 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 1-(1-hydroxybutan-2-yl)-3-methylurea |
| SMILES | CCC(CO)NC(=O)NC |
| InChI | InChI=1S/C6H14N2O2/c1-3-5(4-9)8-6(10)7-2/h5,9H,3-4H2,1-2H3,(H2,7,8,10) |
| InChIKey | LPIICDOTEHHWAK-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |