C7H17N3O — CID 130928964
1-[(2R)-1-hydroxybutan-2-yl]-2,3-dimethylguanidine (PubChem CID 130928964) has the molecular formula C7H17N3O and a molecular weight of 159.23 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxybutan-2-yl]-2,3-dimethylguanidine.
| Compound Name | 1-[(2R)-1-hydroxybutan-2-yl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 130928964 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | 1-[(2R)-1-hydroxybutan-2-yl]-2,3-dimethylguanidine |
| SMILES | CC[C@H](CO)N/C(=N/C)NC |
| InChI | InChI=1S/C7H17N3O/c1-4-6(5-11)10-7(8-2)9-3/h6,11H,4-5H2,1-3H3,(H2,8,9,10)/t6-/m1/s1 |
| InChIKey | GGNYPAORKZJRJI-ZCFIWIBFSA-N |
| XLogP | -0.45 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|