C18H39N3 — CID 123864753
2-methyl-1,3-di(octan-4-yl)guanidine (PubChem CID 123864753) has the molecular formula C18H39N3 and a molecular weight of 297.53 g/mol. Its IUPAC name is 2-methyl-1,3-di(octan-4-yl)guanidine.
| Compound Name | 2-methyl-1,3-di(octan-4-yl)guanidine |
|---|---|
| PubChem CID | 123864753 |
| Molecular Formula | C18H39N3 |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.31 |
| IUPAC Name | 2-methyl-1,3-di(octan-4-yl)guanidine |
| SMILES | CCCCC(CCC)NC(=NC)NC(CCC)CCCC |
| InChI | InChI=1S/C18H39N3/c1-6-10-14-16(12-8-3)20-18(19-5)21-17(13-9-4)15-11-7-2/h16-17H,6-15H2,1-5H3,(H2,19,20,21) |
| InChIKey | KULGOTXMWJQBER-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|