C7H16N2O2 — CID 104981793
3-[(2S)-1-hydroxybutan-2-yl]-1,1-dimethylurea (PubChem CID 104981793) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-[(2S)-1-hydroxybutan-2-yl]-1,1-dimethylurea.
| Compound Name | 3-[(2S)-1-hydroxybutan-2-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 104981793 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | 3-[(2S)-1-hydroxybutan-2-yl]-1,1-dimethylurea |
| SMILES | CC[C@@H](CO)NC(=O)N(C)C |
| InChI | InChI=1S/C7H16N2O2/c1-4-6(5-10)8-7(11)9(2)3/h6,10H,4-5H2,1-3H3,(H,8,11)/t6-/m0/s1 |
| InChIKey | MQDBJGRHGHCWED-LURJTMIESA-N |
| XLogP | 0.03 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |