C9H21N3O — CID 80697976
3-(1-aminohexan-2-yl)-1,1-dimethylurea (PubChem CID 80697976) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-(1-aminohexan-2-yl)-1,1-dimethylurea.
| Compound Name | 3-(1-aminohexan-2-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 80697976 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 3-(1-aminohexan-2-yl)-1,1-dimethylurea |
| SMILES | CCCCC(CN)NC(=O)N(C)C |
| InChI | InChI=1S/C9H21N3O/c1-4-5-6-8(7-10)11-9(13)12(2)3/h8H,4-7,10H2,1-3H3,(H,11,13) |
| InChIKey | OXDVVUVXTQNNEX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |