C14H31ClN2O — CID 119666304
N-(1-aminohexan-2-yl)-2,2,4-trimethylpentanamide;hydrochloride (PubChem CID 119666304) has the molecular formula C14H31ClN2O and a molecular weight of 278.87 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2,2,4-trimethylpentanamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-2,2,4-trimethylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119666304 |
| Molecular Formula | C14H31ClN2O |
| Molecular Weight | 278.87 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2,2,4-trimethylpentanamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)C(C)(C)CC(C)C.Cl |
| InChI | InChI=1S/C14H30N2O.ClH/c1-6-7-8-12(10-15)16-13(17)14(4,5)9-11(2)3;/h11-12H,6-10,15H2,1-5H3,(H,16,17);1H |
| InChIKey | XWZAWJLMNQKBRU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.87 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |