C14H25ClN2OS — CID 119667782
N-(1-aminohexan-2-yl)-2-methyl-2-thiophen-2-ylpropanamide;hydrochloride (PubChem CID 119667782) has the molecular formula C14H25ClN2OS and a molecular weight of 304.89 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-methyl-2-thiophen-2-ylpropanamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-2-methyl-2-thiophen-2-ylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119667782 |
| Molecular Formula | C14H25ClN2OS |
| Molecular Weight | 304.89 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-methyl-2-thiophen-2-ylpropanamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)C(C)(C)c1cccs1.Cl |
| InChI | InChI=1S/C14H24N2OS.ClH/c1-4-5-7-11(10-15)16-13(17)14(2,3)12-8-6-9-18-12;/h6,8-9,11H,4-5,7,10,15H2,1-3H3,(H,16,17);1H |
| InChIKey | IPUABAMYEPZAJE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.89 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |