C16H24ClN3OS — CID 119668727
N-(1-aminohexan-2-yl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide;hydrochloride (PubChem CID 119668727) has the molecular formula C16H24ClN3OS and a molecular weight of 341.91 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119668727 |
| Molecular Formula | C16H24ClN3OS |
| Molecular Weight | 341.91 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(1-aminohexan-2-yl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1cccn1Cc1cccs1.Cl |
| InChI | InChI=1S/C16H23N3OS.ClH/c1-2-3-6-13(11-17)18-16(20)15-8-4-9-19(15)12-14-7-5-10-21-14;/h4-5,7-10,13H,2-3,6,11-12,17H2,1H3,(H,18,20);1H |
| InChIKey | ZYEGCVHPSNTVKI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.91 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |