C14H20ClN3OS — CID 119499620
N-(3-aminobutyl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide;hydrochloride (PubChem CID 119499620) has the molecular formula C14H20ClN3OS and a molecular weight of 313.85 g/mol. Its IUPAC name is N-(3-aminobutyl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119499620 |
| Molecular Formula | C14H20ClN3OS |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-(3-aminobutyl)-1-(thiophen-2-ylmethyl)pyrrole-2-carboxamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)c1cccn1Cc1cccs1.Cl |
| InChI | InChI=1S/C14H19N3OS.ClH/c1-11(15)6-7-16-14(18)13-5-2-8-17(13)10-12-4-3-9-19-12;/h2-5,8-9,11H,6-7,10,15H2,1H3,(H,16,18);1H |
| InChIKey | GLDMFGQCDQWWDC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |